C16H22ClN — CID 55223192
1-(2-bicyclo[2.2.1]heptanyl)-3-(3-chlorophenyl)propan-2-amine (PubChem CID 55223192) has the molecular formula C16H22ClN and a molecular weight of 263.81 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-3-(3-chlorophenyl)propan-2-amine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-(3-chlorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 55223192 |
| Molecular Formula | C16H22ClN |
| Molecular Weight | 263.81 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-(3-chlorophenyl)propan-2-amine |
| SMILES | NC(Cc1cccc(Cl)c1)CC1CC2CCC1C2 |
| InChI | InChI=1S/C16H22ClN/c17-15-3-1-2-11(8-15)9-16(18)10-14-7-12-4-5-13(14)6-12/h1-3,8,12-14,16H,4-7,9-10,18H2 |
| InChIKey | JNFZGRSMYVSVKB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.81 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |