C17H21FO2 — CID 79558031
2-(2-bicyclo[2.2.1]heptanylmethyl)-3-(3-fluorophenyl)propanoic acid (PubChem CID 79558031) has the molecular formula C17H21FO2 and a molecular weight of 276.35 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylmethyl)-3-(3-fluorophenyl)propanoic acid.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylmethyl)-3-(3-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 79558031 |
| Molecular Formula | C17H21FO2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylmethyl)-3-(3-fluorophenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1cccc(F)c1)CC1CC2CCC1C2 |
| InChI | InChI=1S/C17H21FO2/c18-16-3-1-2-11(9-16)8-15(17(19)20)10-14-7-12-4-5-13(14)6-12/h1-3,9,12-15H,4-8,10H2,(H,19,20) |
| InChIKey | KZEDUYAHEDKFCJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |