C17H20Cl2N2O2 — CID 108502946
N'-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-N-(2,4-dichlorophenyl)oxamide (PubChem CID 108502946) has the molecular formula C17H20Cl2N2O2 and a molecular weight of 355.27 g/mol. Its IUPAC name is N'-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-N-(2,4-dichlorophenyl)oxamide.
| Compound Name | N'-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-N-(2,4-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 108502946 |
| Molecular Formula | C17H20Cl2N2O2 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N'-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-N-(2,4-dichlorophenyl)oxamide |
| SMILES | CC(NC(=O)C(=O)Nc1ccc(Cl)cc1Cl)C1CC2CCC1C2 |
| InChI | InChI=1S/C17H20Cl2N2O2/c1-9(13-7-10-2-3-11(13)6-10)20-16(22)17(23)21-15-5-4-12(18)8-14(15)19/h4-5,8-11,13H,2-3,6-7H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | JUHVCJPMCBRVIO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|