C18H25ClN2O — CID 4852472
2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-N-(4-chloro-2-methylphenyl)acetamide (PubChem CID 4852472) has the molecular formula C18H25ClN2O and a molecular weight of 320.86 g/mol. Its IUPAC name is 2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-N-(4-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-N-(4-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 4852472 |
| Molecular Formula | C18H25ClN2O |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-N-(4-chloro-2-methylphenyl)acetamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)CNC(C)C1CC2CCC1C2 |
| InChI | InChI=1S/C18H25ClN2O/c1-11-7-15(19)5-6-17(11)21-18(22)10-20-12(2)16-9-13-3-4-14(16)8-13/h5-7,12-14,16,20H,3-4,8-10H2,1-2H3,(H,21,22) |
| InChIKey | MMDVAAHUYCSIFS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |