C16H20ClNO2 — CID 63512018
2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-4-chlorobenzoic acid (PubChem CID 63512018) has the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. Its IUPAC name is 2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-4-chlorobenzoic acid.
| Compound Name | 2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 63512018 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-4-chlorobenzoic acid |
| SMILES | CC(Nc1cc(Cl)ccc1C(=O)O)C1CC2CCC1C2 |
| InChI | InChI=1S/C16H20ClNO2/c1-9(14-7-10-2-3-11(14)6-10)18-15-8-12(17)4-5-13(15)16(19)20/h4-5,8-11,14,18H,2-3,6-7H2,1H3,(H,19,20) |
| InChIKey | NJKMVASPMZREFK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |