C16H20FNO2 — CID 63538624
2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-3-fluorobenzoic acid (PubChem CID 63538624) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is 2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-3-fluorobenzoic acid.
| Compound Name | 2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 63538624 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-3-fluorobenzoic acid |
| SMILES | CC(Nc1c(F)cccc1C(=O)O)C1CC2CCC1C2 |
| InChI | InChI=1S/C16H20FNO2/c1-9(13-8-10-5-6-11(13)7-10)18-15-12(16(19)20)3-2-4-14(15)17/h2-4,9-11,13,18H,5-8H2,1H3,(H,19,20) |
| InChIKey | MHERJCFGBZEOKQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |