C15H18FNO2 — CID 106987792
2-(2-amino-3-fluorophenyl)-2-(2-bicyclo[2.2.1]heptanyl)acetic acid (PubChem CID 106987792) has the molecular formula C15H18FNO2 and a molecular weight of 263.31 g/mol. Its IUPAC name is 2-(2-amino-3-fluorophenyl)-2-(2-bicyclo[2.2.1]heptanyl)acetic acid.
| Compound Name | 2-(2-amino-3-fluorophenyl)-2-(2-bicyclo[2.2.1]heptanyl)acetic acid |
|---|---|
| PubChem CID | 106987792 |
| Molecular Formula | C15H18FNO2 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-(2-amino-3-fluorophenyl)-2-(2-bicyclo[2.2.1]heptanyl)acetic acid |
| SMILES | Nc1c(F)cccc1C(C(=O)O)C1CC2CCC1C2 |
| InChI | InChI=1S/C15H18FNO2/c16-12-3-1-2-10(14(12)17)13(15(18)19)11-7-8-4-5-9(11)6-8/h1-3,8-9,11,13H,4-7,17H2,(H,18,19) |
| InChIKey | BJJUQCXGXBSVSR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|