C15H22N2O2 — CID 21204164
1-(2-bicyclo[2.2.1]heptanyl)ethanamine;pyridine-4-carboxylic acid (PubChem CID 21204164) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)ethanamine;pyridine-4-carboxylic acid.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)ethanamine;pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 21204164 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)ethanamine;pyridine-4-carboxylic acid |
| SMILES | CC(N)C1CC2CCC1C2.O=C(O)c1ccncc1 |
| InChI | InChI=1S/C9H17N.C6H5NO2/c1-6(10)9-5-7-2-3-8(9)4-7;8-6(9)5-1-3-7-4-2-5/h6-9H,2-5,10H2,1H3;1-4H,(H,8,9) |
| InChIKey | WGMQUFJTQIWQED-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |