C23H19ClO3 — CID 7749903
[(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 2,2-diphenylacetate (PubChem CID 7749903) has the molecular formula C23H19ClO3 and a molecular weight of 378.86 g/mol. Its IUPAC name is [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 2,2-diphenylacetate.
| Compound Name | [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 7749903 |
| Molecular Formula | C23H19ClO3 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 2,2-diphenylacetate |
| SMILES | C[C@H](OC(=O)C(c1ccccc1)c1ccccc1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H19ClO3/c1-16(22(25)19-12-14-20(24)15-13-19)27-23(26)21(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-16,21H,1H3/t16-/m0/s1 |
| InChIKey | OICAITQINNAROK-INIZCTEOSA-N |
| XLogP | 5.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |