C21H22ClNO4 — CID 16564578
[1-(4-chlorophenyl)-1-oxopropan-2-yl] (2S)-2-benzamido-3-methylbutanoate (PubChem CID 16564578) has the molecular formula C21H22ClNO4 and a molecular weight of 387.86 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-1-oxopropan-2-yl] (2S)-2-benzamido-3-methylbutanoate.
| Compound Name | [1-(4-chlorophenyl)-1-oxopropan-2-yl] (2S)-2-benzamido-3-methylbutanoate |
|---|---|
| PubChem CID | 16564578 |
| Molecular Formula | C21H22ClNO4 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | [1-(4-chlorophenyl)-1-oxopropan-2-yl] (2S)-2-benzamido-3-methylbutanoate |
| SMILES | CC(OC(=O)[C@@H](NC(=O)c1ccccc1)C(C)C)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClNO4/c1-13(2)18(23-20(25)16-7-5-4-6-8-16)21(26)27-14(3)19(24)15-9-11-17(22)12-10-15/h4-14,18H,1-3H3,(H,23,25)/t14?,18-/m0/s1 |
| InChIKey | ZLIIMGXOBSCCTM-IBYPIGCZSA-N |
| XLogP | 3.91 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |