C22H26N2O4 — CID 7616997
[(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate (PubChem CID 7616997) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate.
| Compound Name | [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 7616997 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
| SMILES | Cc1ccc(C(=O)[C@H](C)OC(=O)[C@@H](NC(=O)Nc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-14(2)19(24-22(27)23-18-8-6-5-7-9-18)21(26)28-16(4)20(25)17-12-10-15(3)11-13-17/h5-14,16,19H,1-4H3,(H2,23,24,27)/t16-,19-/m0/s1 |
| InChIKey | ODEBDPHKVKVQGM-LPHOPBHVSA-N |
| XLogP | 3.96 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |