C25H31NO4 — CID 18270137
(1-oxo-1-phenylpropan-2-yl) (2S)-2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoate (PubChem CID 18270137) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) (2S)-2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoate.
| Compound Name | (1-oxo-1-phenylpropan-2-yl) (2S)-2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 18270137 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) (2S)-2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(OC(=O)[C@@H](NC(=O)c1ccc(C(C)(C)C)cc1)C(C)C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H31NO4/c1-16(2)21(24(29)30-17(3)22(27)18-10-8-7-9-11-18)26-23(28)19-12-14-20(15-13-19)25(4,5)6/h7-17,21H,1-6H3,(H,26,28)/t17?,21-/m0/s1 |
| InChIKey | AONBEKSMOVYNSL-LFABVHOISA-N |
| XLogP | 4.55 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |