C16H22ClNO3 — CID 80703086
tert-butyl (2S)-2-[(4-chlorobenzoyl)amino]-3-methylbutanoate (PubChem CID 80703086) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(4-chlorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | tert-butyl (2S)-2-[(4-chlorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 80703086 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | tert-butyl (2S)-2-[(4-chlorobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(Cl)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22ClNO3/c1-10(2)13(15(20)21-16(3,4)5)18-14(19)11-6-8-12(17)9-7-11/h6-10,13H,1-5H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | STTQHAYICVSEHS-ZDUSSCGKSA-N |
| XLogP | 3.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |