C28H23O4P — CID 159634764
bis(2,2-diphenylacetyl)phosphinic acid (PubChem CID 159634764) has the molecular formula C28H23O4P and a molecular weight of 454.46 g/mol. Its IUPAC name is bis(2,2-diphenylacetyl)phosphinic acid.
| Compound Name | bis(2,2-diphenylacetyl)phosphinic acid |
|---|---|
| PubChem CID | 159634764 |
| Molecular Formula | C28H23O4P |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | bis(2,2-diphenylacetyl)phosphinic acid |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)P(=O)(O)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23O4P/c29-27(25(21-13-5-1-6-14-21)22-15-7-2-8-16-22)33(31,32)28(30)26(23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20,25-26H,(H,31,32) |
| InChIKey | RFJZLDPTJXQUNV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|