C22H22O3 — CID 102259545
[(1R)-1-(furan-2-yl)-2-methylpropyl] 2,2-diphenylacetate (PubChem CID 102259545) has the molecular formula C22H22O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is [(1R)-1-(furan-2-yl)-2-methylpropyl] 2,2-diphenylacetate.
| Compound Name | [(1R)-1-(furan-2-yl)-2-methylpropyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 102259545 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | [(1R)-1-(furan-2-yl)-2-methylpropyl] 2,2-diphenylacetate |
| SMILES | CC(C)[C@@H](OC(=O)C(c1ccccc1)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C22H22O3/c1-16(2)21(19-14-9-15-24-19)25-22(23)20(17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-16,20-21H,1-2H3/t21-/m1/s1 |
| InChIKey | QZVZPQZJYINSSE-OAQYLSRUSA-N |
| XLogP | 5.35 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |