C26H26O4 — CID 122392031
[(1R)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl] 2,2-diphenylacetate (PubChem CID 122392031) has the molecular formula C26H26O4 and a molecular weight of 402.49 g/mol. Its IUPAC name is [(1R)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl] 2,2-diphenylacetate.
| Compound Name | [(1R)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 122392031 |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | [(1R)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl] 2,2-diphenylacetate |
| SMILES | O=C(O[C@H](CCc1ccccc1)C1OCCO1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26O4/c27-25(24(21-12-6-2-7-13-21)22-14-8-3-9-15-22)30-23(26-28-18-19-29-26)17-16-20-10-4-1-5-11-20/h1-15,23-24,26H,16-19H2/t23-/m1/s1 |
| InChIKey | QBIFZMPOKCTGKV-HSZRJFAPSA-N |
| XLogP | 4.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |