About (2S)-N-[(1S)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl]-2-hydroxy-3-methylbutanamide
(2S)-N-[(1S)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl]-2-hydroxy-3-methylbutanamide (PubChem CID 68521140) has the molecular formula C17H25NO4
and a molecular weight of 307.39 g/mol. Its IUPAC name is (2S)-N-[(1S)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl]-2-hydroxy-3-methylbutanamide.
Molecular Properties
| Compound Name | (2S)-N-[(1S)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl]-2-hydroxy-3-methylbutanamide |
| PubChem CID | 68521140 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (2S)-N-[(1S)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl]-2-hydroxy-3-methylbutanamide |
| SMILES | CC(C)[C@H](O)C(=O)N[C@@H](CCc1ccccc1)C1OCCO1 |
| InChI | InChI=1S/C17H25NO4/c1-12(2)15(19)16(20)18-14(17-21-10-11-22-17)9-8-13-6-4-3-5-7-13/h3-7,12,14-15,17,19H,8-11H2,1-2H3,(H,18,20)/t14-,15-/m0/s1 |
| InChIKey | RPEAEGXOIDQXOO-GJZGRUSLSA-N |
| XLogP | 1.49 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-N-[(1S)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl]-2-hydroxy-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[(1S)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl]-2-hydroxy-3-methylbutanamide?
The IUPAC name of (2S)-N-[(1S)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl]-2-hydroxy-3-methylbutanamide (CID 68521140) is (2S)-N-[(1S)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl]-2-hydroxy-3-methylbutanamide.
What is the SMILES notation for (2S)-N-[(1S)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl]-2-hydroxy-3-methylbutanamide?
The canonical SMILES for (2S)-N-[(1S)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl]-2-hydroxy-3-methylbutanamide is CC(C)[C@H](O)C(=O)N[C@@H](CCc1ccccc1)C1OCCO1.
What is the InChIKey of (2S)-N-[(1S)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl]-2-hydroxy-3-methylbutanamide?
The InChIKey is RPEAEGXOIDQXOO-GJZGRUSLSA-N. The full InChI is InChI=1S/C17H25NO4/c1-12(2)15(19)16(20)18-14(17-21-10-11-22-17)9-8-13-6-4-3-5-7-13/h3-7,12,14-15,17,19H,8-11H2,1-2H3,(H,18,20)/t14-,15-/m0/s1.
What are the key properties of (2S)-N-[(1S)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl]-2-hydroxy-3-methylbutanamide?
(2S)-N-[(1S)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl]-2-hydroxy-3-methylbutanamide has a molecular weight of 307.39 g/mol, XLogP of 1.49, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[(1S)-1-(1,3-dioxolan-2-yl)-3-phenylpropyl]-2-hydroxy-3-methylbutanamide is sourced from PubChem (CID 68521140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).