C16H16O2S — CID 146180519
[(1S)-1,3-diphenylpropoxy]methanethioic S-acid (PubChem CID 146180519) has the molecular formula C16H16O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is [(1S)-1,3-diphenylpropoxy]methanethioic S-acid.
| Compound Name | [(1S)-1,3-diphenylpropoxy]methanethioic S-acid |
|---|---|
| PubChem CID | 146180519 |
| Molecular Formula | C16H16O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | [(1S)-1,3-diphenylpropoxy]methanethioic S-acid |
| SMILES | O=C(S)O[C@@H](CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16O2S/c17-16(19)18-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10,15H,11-12H2,(H,17,19)/t15-/m0/s1 |
| InChIKey | ICDXVGXLFXBOMG-HNNXBMFYSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|