C20H23NOS — CID 86100498
O-(1,3-diphenylpropyl) pyrrolidine-1-carbothioate (PubChem CID 86100498) has the molecular formula C20H23NOS and a molecular weight of 325.48 g/mol. Its IUPAC name is O-(1,3-diphenylpropyl) pyrrolidine-1-carbothioate.
| Compound Name | O-(1,3-diphenylpropyl) pyrrolidine-1-carbothioate |
|---|---|
| PubChem CID | 86100498 |
| Molecular Formula | C20H23NOS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | O-(1,3-diphenylpropyl) pyrrolidine-1-carbothioate |
| SMILES | S=C(OC(CCc1ccccc1)c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C20H23NOS/c23-20(21-15-7-8-16-21)22-19(18-11-5-2-6-12-18)14-13-17-9-3-1-4-10-17/h1-6,9-12,19H,7-8,13-16H2 |
| InChIKey | BUBAHAHGZXMIBA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|