C21H21FN2OS — CID 134960606
O-[1-(4-cyano-2-fluorophenyl)-3-phenylpropyl] pyrrolidine-1-carbothioate (PubChem CID 134960606) has the molecular formula C21H21FN2OS and a molecular weight of 368.48 g/mol. Its IUPAC name is O-[1-(4-cyano-2-fluorophenyl)-3-phenylpropyl] pyrrolidine-1-carbothioate.
| Compound Name | O-[1-(4-cyano-2-fluorophenyl)-3-phenylpropyl] pyrrolidine-1-carbothioate |
|---|---|
| PubChem CID | 134960606 |
| Molecular Formula | C21H21FN2OS |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | O-[1-(4-cyano-2-fluorophenyl)-3-phenylpropyl] pyrrolidine-1-carbothioate |
| SMILES | N#Cc1ccc(C(CCc2ccccc2)OC(=S)N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C21H21FN2OS/c22-19-14-17(15-23)8-10-18(19)20(11-9-16-6-2-1-3-7-16)25-21(26)24-12-4-5-13-24/h1-3,6-8,10,14,20H,4-5,9,11-13H2 |
| InChIKey | WNHYPMMPDDNEDV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|