About (1-benzylpiperidin-4-yl) 4-(4-cyano-2-fluorophenyl)piperazine-1-carboxylate
(1-benzylpiperidin-4-yl) 4-(4-cyano-2-fluorophenyl)piperazine-1-carboxylate (PubChem CID 166704412) has the molecular formula C24H27FN4O2
and a molecular weight of 422.50 g/mol. Its IUPAC name is (1-benzylpiperidin-4-yl) 4-(4-cyano-2-fluorophenyl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | (1-benzylpiperidin-4-yl) 4-(4-cyano-2-fluorophenyl)piperazine-1-carboxylate |
| PubChem CID | 166704412 |
| Molecular Formula | C24H27FN4O2 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | (1-benzylpiperidin-4-yl) 4-(4-cyano-2-fluorophenyl)piperazine-1-carboxylate |
| SMILES | N#Cc1ccc(N2CCN(C(=O)OC3CCN(Cc4ccccc4)CC3)CC2)c(F)c1 |
| InChI | InChI=1S/C24H27FN4O2/c25-22-16-20(17-26)6-7-23(22)28-12-14-29(15-13-28)24(30)31-21-8-10-27(11-9-21)18-19-4-2-1-3-5-19/h1-7,16,21H,8-15,18H2 |
| InChIKey | CMLWUHMZSHBOBN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 59.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-benzylpiperidin-4-yl) 4-(4-cyano-2-fluorophenyl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzylpiperidin-4-yl) 4-(4-cyano-2-fluorophenyl)piperazine-1-carboxylate?
The IUPAC name of (1-benzylpiperidin-4-yl) 4-(4-cyano-2-fluorophenyl)piperazine-1-carboxylate (CID 166704412) is (1-benzylpiperidin-4-yl) 4-(4-cyano-2-fluorophenyl)piperazine-1-carboxylate.
What is the SMILES notation for (1-benzylpiperidin-4-yl) 4-(4-cyano-2-fluorophenyl)piperazine-1-carboxylate?
The canonical SMILES for (1-benzylpiperidin-4-yl) 4-(4-cyano-2-fluorophenyl)piperazine-1-carboxylate is N#Cc1ccc(N2CCN(C(=O)OC3CCN(Cc4ccccc4)CC3)CC2)c(F)c1.
What is the InChIKey of (1-benzylpiperidin-4-yl) 4-(4-cyano-2-fluorophenyl)piperazine-1-carboxylate?
The InChIKey is CMLWUHMZSHBOBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27FN4O2/c25-22-16-20(17-26)6-7-23(22)28-12-14-29(15-13-28)24(30)31-21-8-10-27(11-9-21)18-19-4-2-1-3-5-19/h1-7,16,21H,8-15,18H2.
What are the key properties of (1-benzylpiperidin-4-yl) 4-(4-cyano-2-fluorophenyl)piperazine-1-carboxylate?
(1-benzylpiperidin-4-yl) 4-(4-cyano-2-fluorophenyl)piperazine-1-carboxylate has a molecular weight of 422.50 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzylpiperidin-4-yl) 4-(4-cyano-2-fluorophenyl)piperazine-1-carboxylate is sourced from PubChem (CID 166704412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).