C19H20FN3 — CID 21015031
3-[(1-benzylpiperidin-4-yl)amino]-4-fluorobenzonitrile (PubChem CID 21015031) has the molecular formula C19H20FN3 and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-[(1-benzylpiperidin-4-yl)amino]-4-fluorobenzonitrile.
| Compound Name | 3-[(1-benzylpiperidin-4-yl)amino]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 21015031 |
| Molecular Formula | C19H20FN3 |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 3-[(1-benzylpiperidin-4-yl)amino]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)c(NC2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C19H20FN3/c20-18-7-6-16(13-21)12-19(18)22-17-8-10-23(11-9-17)14-15-4-2-1-3-5-15/h1-7,12,17,22H,8-11,14H2 |
| InChIKey | OQUCGLNSDQHYJL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |