C19H29NO — CID 71882918
1-(azocan-1-yl)-3-methyl-5-phenylpentan-1-one (PubChem CID 71882918) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-(azocan-1-yl)-3-methyl-5-phenylpentan-1-one.
| Compound Name | 1-(azocan-1-yl)-3-methyl-5-phenylpentan-1-one |
|---|---|
| PubChem CID | 71882918 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 1-(azocan-1-yl)-3-methyl-5-phenylpentan-1-one |
| SMILES | CC(CCc1ccccc1)CC(=O)N1CCCCCCC1 |
| InChI | InChI=1S/C19H29NO/c1-17(12-13-18-10-6-5-7-11-18)16-19(21)20-14-8-3-2-4-9-15-20/h5-7,10-11,17H,2-4,8-9,12-16H2,1H3 |
| InChIKey | LTGCQQKPWWRVLH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |