C19H28N2O3 — CID 91148922
3-phenylpropyl (2R)-2-amino-5-oxo-5-piperidin-1-ylpentanoate (PubChem CID 91148922) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 3-phenylpropyl (2R)-2-amino-5-oxo-5-piperidin-1-ylpentanoate.
| Compound Name | 3-phenylpropyl (2R)-2-amino-5-oxo-5-piperidin-1-ylpentanoate |
|---|---|
| PubChem CID | 91148922 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 3-phenylpropyl (2R)-2-amino-5-oxo-5-piperidin-1-ylpentanoate |
| SMILES | N[C@H](CCC(=O)N1CCCCC1)C(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C19H28N2O3/c20-17(11-12-18(22)21-13-5-2-6-14-21)19(23)24-15-7-10-16-8-3-1-4-9-16/h1,3-4,8-9,17H,2,5-7,10-15,20H2/t17-/m1/s1 |
| InChIKey | LDSKCOITGPZBHD-QGZVFWFLSA-N |
| XLogP | 2.28 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|