C22H25NOS — CID 102588584
O-[(E)-1,5-diphenylpent-1-en-3-yl] pyrrolidine-1-carbothioate (PubChem CID 102588584) has the molecular formula C22H25NOS and a molecular weight of 351.52 g/mol. Its IUPAC name is O-[(E)-1,5-diphenylpent-1-en-3-yl] pyrrolidine-1-carbothioate.
| Compound Name | O-[(E)-1,5-diphenylpent-1-en-3-yl] pyrrolidine-1-carbothioate |
|---|---|
| PubChem CID | 102588584 |
| Molecular Formula | C22H25NOS |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | O-[(E)-1,5-diphenylpent-1-en-3-yl] pyrrolidine-1-carbothioate |
| SMILES | S=C(OC(/C=C/c1ccccc1)CCc1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C22H25NOS/c25-22(23-17-7-8-18-23)24-21(15-13-19-9-3-1-4-10-19)16-14-20-11-5-2-6-12-20/h1-6,9-13,15,21H,7-8,14,16-18H2/b15-13+ |
| InChIKey | GLUSQRCTEMHPLY-FYWRMAATSA-N |
| XLogP | 5.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|