About [(Z)-2-phenylethenyl] piperidine-1-carbodithioate
[(Z)-2-phenylethenyl] piperidine-1-carbodithioate (PubChem CID 102083338) has the molecular formula C14H17NS2
and a molecular weight of 263.43 g/mol. Its IUPAC name is [(Z)-2-phenylethenyl] piperidine-1-carbodithioate.
Molecular Properties
| Compound Name | [(Z)-2-phenylethenyl] piperidine-1-carbodithioate |
| PubChem CID | 102083338 |
| Molecular Formula | C14H17NS2 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | [(Z)-2-phenylethenyl] piperidine-1-carbodithioate |
| SMILES | S=C(S/C=C\c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C14H17NS2/c16-14(15-10-5-2-6-11-15)17-12-9-13-7-3-1-4-8-13/h1,3-4,7-9,12H,2,5-6,10-11H2/b12-9- |
| InChIKey | BNBAPMGPHPZLBX-XFXZXTDPSA-N |
| XLogP | 4.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-2-phenylethenyl] piperidine-1-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-2-phenylethenyl] piperidine-1-carbodithioate?
The IUPAC name of [(Z)-2-phenylethenyl] piperidine-1-carbodithioate (CID 102083338) is [(Z)-2-phenylethenyl] piperidine-1-carbodithioate.
What is the SMILES notation for [(Z)-2-phenylethenyl] piperidine-1-carbodithioate?
The canonical SMILES for [(Z)-2-phenylethenyl] piperidine-1-carbodithioate is S=C(S/C=C\c1ccccc1)N1CCCCC1.
What is the InChIKey of [(Z)-2-phenylethenyl] piperidine-1-carbodithioate?
The InChIKey is BNBAPMGPHPZLBX-XFXZXTDPSA-N. The full InChI is InChI=1S/C14H17NS2/c16-14(15-10-5-2-6-11-15)17-12-9-13-7-3-1-4-8-13/h1,3-4,7-9,12H,2,5-6,10-11H2/b12-9-.
What are the key properties of [(Z)-2-phenylethenyl] piperidine-1-carbodithioate?
[(Z)-2-phenylethenyl] piperidine-1-carbodithioate has a molecular weight of 263.43 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-2-phenylethenyl] piperidine-1-carbodithioate is sourced from PubChem (CID 102083338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).