C31H33NO3S2 — CID 87713844
O-(1,5-diphenyl-3-sulfanylpentyl) 1-(2-oxo-2-phenylacetyl)piperidine-2-carbothioate (PubChem CID 87713844) has the molecular formula C31H33NO3S2 and a molecular weight of 531.74 g/mol. Its IUPAC name is O-(1,5-diphenyl-3-sulfanylpentyl) 1-(2-oxo-2-phenylacetyl)piperidine-2-carbothioate.
| Compound Name | O-(1,5-diphenyl-3-sulfanylpentyl) 1-(2-oxo-2-phenylacetyl)piperidine-2-carbothioate |
|---|---|
| PubChem CID | 87713844 |
| Molecular Formula | C31H33NO3S2 |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | O-(1,5-diphenyl-3-sulfanylpentyl) 1-(2-oxo-2-phenylacetyl)piperidine-2-carbothioate |
| SMILES | O=C(C(=O)N1CCCCC1C(=S)OC(CC(S)CCc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H33NO3S2/c33-29(25-16-8-3-9-17-25)30(34)32-21-11-10-18-27(32)31(37)35-28(24-14-6-2-7-15-24)22-26(36)20-19-23-12-4-1-5-13-23/h1-9,12-17,26-28,36H,10-11,18-22H2 |
| InChIKey | WJNZYTPBZMBLKN-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|