C17H18F6O4 — CID 102457441
1,1,1,3,3,3-hexafluoropropan-2-yl (4R)-4-(1,3-dioxolan-2-yl)-5-phenylpentanoate (PubChem CID 102457441) has the molecular formula C17H18F6O4 and a molecular weight of 400.32 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl (4R)-4-(1,3-dioxolan-2-yl)-5-phenylpentanoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (4R)-4-(1,3-dioxolan-2-yl)-5-phenylpentanoate |
|---|---|
| PubChem CID | 102457441 |
| Molecular Formula | C17H18F6O4 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (4R)-4-(1,3-dioxolan-2-yl)-5-phenylpentanoate |
| SMILES | O=C(CC[C@H](Cc1ccccc1)C1OCCO1)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H18F6O4/c18-16(19,20)15(17(21,22)23)27-13(24)7-6-12(14-25-8-9-26-14)10-11-4-2-1-3-5-11/h1-5,12,14-15H,6-10H2/t12-/m1/s1 |
| InChIKey | ZLGDEQJGBRNXOW-GFCCVEGCSA-N |
| XLogP | 4.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |