C17H21F6N3O2 — CID 151837035
1,1,1,3,3,3-hexafluoropropan-2-yl 3-[2-[2-(2-phenylethyl)hydrazinyl]ethyl]azetidine-1-carboxylate (PubChem CID 151837035) has the molecular formula C17H21F6N3O2 and a molecular weight of 413.36 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 3-[2-[2-(2-phenylethyl)hydrazinyl]ethyl]azetidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3-[2-[2-(2-phenylethyl)hydrazinyl]ethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 151837035 |
| Molecular Formula | C17H21F6N3O2 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3-[2-[2-(2-phenylethyl)hydrazinyl]ethyl]azetidine-1-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CC(CCNNCCc2ccccc2)C1 |
| InChI | InChI=1S/C17H21F6N3O2/c18-16(19,20)14(17(21,22)23)28-15(27)26-10-13(11-26)7-9-25-24-8-6-12-4-2-1-3-5-12/h1-5,13-14,24-25H,6-11H2 |
| InChIKey | SFWINVSABCUCAZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|