C21H22F6N4O2 — CID 90465979
1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(1-methyl-3-phenylpyrazol-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 90465979) has the molecular formula C21H22F6N4O2 and a molecular weight of 476.42 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(1-methyl-3-phenylpyrazol-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(1-methyl-3-phenylpyrazol-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 90465979 |
| Molecular Formula | C21H22F6N4O2 |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(1-methyl-3-phenylpyrazol-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | Cn1cc(CN2CC3CN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC3C2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H22F6N4O2/c1-29-7-16(17(28-29)13-5-3-2-4-6-13)10-30-8-14-11-31(12-15(14)9-30)19(32)33-18(20(22,23)24)21(25,26)27/h2-7,14-15,18H,8-12H2,1H3 |
| InChIKey | GUPMECCZRLCQFP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |