C15H16F6N2O2S — CID 123818864
1,1,1,3,3,3-hexafluoropropan-2-yl 4-(2-methylphenyl)sulfanylpiperazine-1-carboxylate (PubChem CID 123818864) has the molecular formula C15H16F6N2O2S and a molecular weight of 402.36 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(2-methylphenyl)sulfanylpiperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(2-methylphenyl)sulfanylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 123818864 |
| Molecular Formula | C15H16F6N2O2S |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(2-methylphenyl)sulfanylpiperazine-1-carboxylate |
| SMILES | Cc1ccccc1SN1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H16F6N2O2S/c1-10-4-2-3-5-11(10)26-23-8-6-22(7-9-23)13(24)25-12(14(16,17)18)15(19,20)21/h2-5,12H,6-9H2,1H3 |
| InChIKey | TVDVUXLRBQBJEE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|