C16H19F3N2O3S — CID 123541452
(1,1,1-trifluoro-3-oxobutan-2-yl) 4-(2-methylphenyl)sulfanylpiperazine-1-carboxylate (PubChem CID 123541452) has the molecular formula C16H19F3N2O3S and a molecular weight of 376.40 g/mol. Its IUPAC name is (1,1,1-trifluoro-3-oxobutan-2-yl) 4-(2-methylphenyl)sulfanylpiperazine-1-carboxylate.
| Compound Name | (1,1,1-trifluoro-3-oxobutan-2-yl) 4-(2-methylphenyl)sulfanylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 123541452 |
| Molecular Formula | C16H19F3N2O3S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (1,1,1-trifluoro-3-oxobutan-2-yl) 4-(2-methylphenyl)sulfanylpiperazine-1-carboxylate |
| SMILES | CC(=O)C(OC(=O)N1CCN(Sc2ccccc2C)CC1)C(F)(F)F |
| InChI | InChI=1S/C16H19F3N2O3S/c1-11-5-3-4-6-13(11)25-21-9-7-20(8-10-21)15(23)24-14(12(2)22)16(17,18)19/h3-6,14H,7-10H2,1-2H3 |
| InChIKey | IIEKLKHSCFHSHU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|