C14H14F6N2O2S — CID 123834989
1,1,1,3,3,3-hexafluoropropan-2-yl 4-phenylsulfanylpiperazine-1-carboxylate (PubChem CID 123834989) has the molecular formula C14H14F6N2O2S and a molecular weight of 388.33 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-phenylsulfanylpiperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-phenylsulfanylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 123834989 |
| Molecular Formula | C14H14F6N2O2S |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-phenylsulfanylpiperazine-1-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCN(Sc2ccccc2)CC1 |
| InChI | InChI=1S/C14H14F6N2O2S/c15-13(16,17)11(14(18,19)20)24-12(23)21-6-8-22(9-7-21)25-10-4-2-1-3-5-10/h1-5,11H,6-9H2 |
| InChIKey | HRHOHYMKGRQJGM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|