C9H11BF9N2O2- — CID 140741496
trifluoro-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]boranuide (PubChem CID 140741496) has the molecular formula C9H11BF9N2O2- and a molecular weight of 360.99 g/mol. Its IUPAC name is trifluoro-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]boranuide.
| Compound Name | trifluoro-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]boranuide |
|---|---|
| PubChem CID | 140741496 |
| Molecular Formula | C9H11BF9N2O2- |
| Molecular Weight | 360.99 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | trifluoro-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]boranuide |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCN(C[B-](F)(F)F)CC1 |
| InChI | InChI=1S/C9H11BF9N2O2/c11-8(12,13)6(9(14,15)16)23-7(22)21-3-1-20(2-4-21)5-10(17,18)19/h6H,1-5H2/q-1 |
| InChIKey | VFNUKLUMTSBOOK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.99 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|