C16H20F6N2O2 — CID 156577413
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine-1-carboxylate (PubChem CID 156577413) has the molecular formula C16H20F6N2O2 and a molecular weight of 386.34 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 156577413 |
| Molecular Formula | C16H20F6N2O2 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]piperazine-1-carboxylate |
| SMILES | C=C/C=C\C(=C/C)CN1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H20F6N2O2/c1-3-5-6-12(4-2)11-23-7-9-24(10-8-23)14(25)26-13(15(17,18)19)16(20,21)22/h3-6,13H,1,7-11H2,2H3/b6-5-,12-4+ |
| InChIKey | UHWWRJBJQGMKIN-JWUPWDRQSA-N |
| XLogP | 3.92 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|