C19H21F7N4O2 — CID 156530475
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-fluoro-4-[(methylideneamino)-[(Z)-prop-1-enyl]amino]phenyl]methyl]piperazine-1-carboxylate (PubChem CID 156530475) has the molecular formula C19H21F7N4O2 and a molecular weight of 470.39 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-fluoro-4-[(methylideneamino)-[(Z)-prop-1-enyl]amino]phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-fluoro-4-[(methylideneamino)-[(Z)-prop-1-enyl]amino]phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 156530475 |
| Molecular Formula | C19H21F7N4O2 |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[3-fluoro-4-[(methylideneamino)-[(Z)-prop-1-enyl]amino]phenyl]methyl]piperazine-1-carboxylate |
| SMILES | C=NN(/C=C\C)c1ccc(CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)cc1F |
| InChI | InChI=1S/C19H21F7N4O2/c1-3-6-30(27-2)15-5-4-13(11-14(15)20)12-28-7-9-29(10-8-28)17(31)32-16(18(21,22)23)19(24,25)26/h3-6,11,16H,2,7-10,12H2,1H3/b6-3- |
| InChIKey | YNHDZTKSPRGAQA-UTCJRWHESA-N |
| XLogP | 4.53 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|