C24H28F6N2O5 — CID 158324640
4-[5-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-2-methylbenzoyl]cyclohexane-1-carboxylic acid (PubChem CID 158324640) has the molecular formula C24H28F6N2O5 and a molecular weight of 538.49 g/mol. Its IUPAC name is 4-[5-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-2-methylbenzoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[5-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-2-methylbenzoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 158324640 |
| Molecular Formula | C24H28F6N2O5 |
| Molecular Weight | 538.49 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 4-[5-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-2-methylbenzoyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)cc1C(=O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C24H28F6N2O5/c1-14-2-3-15(12-18(14)19(33)16-4-6-17(7-5-16)20(34)35)13-31-8-10-32(11-9-31)22(36)37-21(23(25,26)27)24(28,29)30/h2-3,12,16-17,21H,4-11,13H2,1H3,(H,34,35) |
| InChIKey | GPGKECZJLHQFSB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |