C24H26F9N3O4 — CID 134365462
2-[(3R)-1-[3-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)phenyl]piperidin-3-yl]prop-2-enoic acid (PubChem CID 134365462) has the molecular formula C24H26F9N3O4 and a molecular weight of 591.47 g/mol. Its IUPAC name is 2-[(3R)-1-[3-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)phenyl]piperidin-3-yl]prop-2-enoic acid.
| Compound Name | 2-[(3R)-1-[3-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)phenyl]piperidin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134365462 |
| Molecular Formula | C24H26F9N3O4 |
| Molecular Weight | 591.47 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | 2-[(3R)-1-[3-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)phenyl]piperidin-3-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)[C@H]1CCCN(c2cc(CN3CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC3)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C24H26F9N3O4/c1-14(19(37)38)16-3-2-4-36(13-16)18-10-15(9-17(11-18)22(25,26)27)12-34-5-7-35(8-6-34)21(39)40-20(23(28,29)30)24(31,32)33/h9-11,16,20H,1-8,12-13H2,(H,37,38)/t16-/m0/s1 |
| InChIKey | IKTQTLQEAMBEBK-INIZCTEOSA-N |
| XLogP | 5.31 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|