C21H22F9N3O4 — CID 122530036
(2S)-1-[5-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-2-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylic acid (PubChem CID 122530036) has the molecular formula C21H22F9N3O4 and a molecular weight of 551.41 g/mol. Its IUPAC name is (2S)-1-[5-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-2-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[5-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-2-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122530036 |
| Molecular Formula | C21H22F9N3O4 |
| Molecular Weight | 551.41 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | (2S)-1-[5-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-2-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1c1cc(CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)ccc1C(F)(F)F |
| InChI | InChI=1S/C21H22F9N3O4/c22-19(23,24)13-4-3-12(10-15(13)33-5-1-2-14(33)16(34)35)11-31-6-8-32(9-7-31)18(36)37-17(20(25,26)27)21(28,29)30/h3-4,10,14,17H,1-2,5-9,11H2,(H,34,35)/t14-/m0/s1 |
| InChIKey | UIXHQEPGRYTIKV-AWEZNQCLSA-N |
| XLogP | 4.51 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |