C26H30F9N3O4 — CID 145401342
1-[3-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]-5-(trifluoromethyl)phenyl]piperidine-3-carboxylic acid (PubChem CID 145401342) has the molecular formula C26H30F9N3O4 and a molecular weight of 619.53 g/mol. Its IUPAC name is 1-[3-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]-5-(trifluoromethyl)phenyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[3-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]-5-(trifluoromethyl)phenyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 145401342 |
| Molecular Formula | C26H30F9N3O4 |
| Molecular Weight | 619.53 g/mol |
| Exact Mass | 619.21 |
| IUPAC Name | 1-[3-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]-5-(trifluoromethyl)phenyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(c2cc(CN3CCCC34CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC4)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C26H30F9N3O4/c27-24(28,29)18-11-16(12-19(13-18)37-7-1-3-17(15-37)20(39)40)14-38-8-2-4-23(38)5-9-36(10-6-23)22(41)42-21(25(30,31)32)26(33,34)35/h11-13,17,21H,1-10,14-15H2,(H,39,40) |
| InChIKey | CTZFPCTZEUMKBS-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |