C25H31F7N2O2 — CID 142538617
1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[3-fluoro-5-(1-methylcyclopentyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 142538617) has the molecular formula C25H31F7N2O2 and a molecular weight of 524.52 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[3-fluoro-5-(1-methylcyclopentyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[3-fluoro-5-(1-methylcyclopentyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 142538617 |
| Molecular Formula | C25H31F7N2O2 |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[3-fluoro-5-(1-methylcyclopentyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | CC1(c2cc(F)cc(CN3CCCC34CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC4)c2)CCCC1 |
| InChI | InChI=1S/C25H31F7N2O2/c1-22(5-2-3-6-22)18-13-17(14-19(26)15-18)16-34-10-4-7-23(34)8-11-33(12-9-23)21(35)36-20(24(27,28)29)25(30,31)32/h13-15,20H,2-12,16H2,1H3 |
| InChIKey | STIMFOBOMUSQAW-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |