C25H30F9N3O3 — CID 145401336
1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-(2-methylmorpholin-4-yl)-4-(trifluoromethyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 145401336) has the molecular formula C25H30F9N3O3 and a molecular weight of 591.52 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-(2-methylmorpholin-4-yl)-4-(trifluoromethyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-(2-methylmorpholin-4-yl)-4-(trifluoromethyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 145401336 |
| Molecular Formula | C25H30F9N3O3 |
| Molecular Weight | 591.52 g/mol |
| Exact Mass | 591.21 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-(2-methylmorpholin-4-yl)-4-(trifluoromethyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | CC1CN(c2cc(C(F)(F)F)ccc2CN2CCCC23CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC3)CCO1 |
| InChI | InChI=1S/C25H30F9N3O3/c1-16-14-36(11-12-39-16)19-13-18(23(26,27)28)4-3-17(19)15-37-8-2-5-22(37)6-9-35(10-7-22)21(38)40-20(24(29,30)31)25(32,33)34/h3-4,13,16,20H,2,5-12,14-15H2,1H3 |
| InChIKey | UCZVDMDCKSNGEG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |