C25H28F9N3O5 — CID 155921900
1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-(2-formyloxymorpholin-4-yl)-4-(trifluoromethyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 155921900) has the molecular formula C25H28F9N3O5 and a molecular weight of 621.50 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-(2-formyloxymorpholin-4-yl)-4-(trifluoromethyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-(2-formyloxymorpholin-4-yl)-4-(trifluoromethyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 155921900 |
| Molecular Formula | C25H28F9N3O5 |
| Molecular Weight | 621.50 g/mol |
| Exact Mass | 621.19 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-(2-formyloxymorpholin-4-yl)-4-(trifluoromethyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | O=COC1CN(c2cc(C(F)(F)F)ccc2CN2CCCC23CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC3)CCO1 |
| InChI | InChI=1S/C25H28F9N3O5/c26-23(27,28)17-3-2-16(18(12-17)36-10-11-40-19(14-36)41-15-38)13-37-7-1-4-22(37)5-8-35(9-6-22)21(39)42-20(24(29,30)31)25(32,33)34/h2-3,12,15,19-20H,1,4-11,13-14H2 |
| InChIKey | QQFZVXDBTCOBAL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|