C25H32F9N3O3 — CID 145401379
1,1,1,3,3,3-hexafluoropropan-2-yl 4-ethyl-4-[ethyl-[[2-morpholin-4-yl-4-(trifluoromethyl)phenyl]methyl]amino]piperidine-1-carboxylate (PubChem CID 145401379) has the molecular formula C25H32F9N3O3 and a molecular weight of 593.53 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-ethyl-4-[ethyl-[[2-morpholin-4-yl-4-(trifluoromethyl)phenyl]methyl]amino]piperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-ethyl-4-[ethyl-[[2-morpholin-4-yl-4-(trifluoromethyl)phenyl]methyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 145401379 |
| Molecular Formula | C25H32F9N3O3 |
| Molecular Weight | 593.53 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-ethyl-4-[ethyl-[[2-morpholin-4-yl-4-(trifluoromethyl)phenyl]methyl]amino]piperidine-1-carboxylate |
| SMILES | CCN(Cc1ccc(C(F)(F)F)cc1N1CCOCC1)C1(CC)CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C25H32F9N3O3/c1-3-22(7-9-36(10-8-22)21(38)40-20(24(29,30)31)25(32,33)34)37(4-2)16-17-5-6-18(23(26,27)28)15-19(17)35-11-13-39-14-12-35/h5-6,15,20H,3-4,7-14,16H2,1-2H3 |
| InChIKey | LQSJTHZVPCVNLO-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.53 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |