C22H24F9N3O5 — CID 134365460
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[3-formyl-3-(hydroxymethyl)morpholin-4-yl]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 134365460) has the molecular formula C22H24F9N3O5 and a molecular weight of 581.43 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[3-formyl-3-(hydroxymethyl)morpholin-4-yl]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[3-formyl-3-(hydroxymethyl)morpholin-4-yl]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134365460 |
| Molecular Formula | C22H24F9N3O5 |
| Molecular Weight | 581.43 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[3-formyl-3-(hydroxymethyl)morpholin-4-yl]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | O=CC1(CO)COCCN1c1cc(C(F)(F)F)ccc1CN1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H24F9N3O5/c23-20(24,25)15-2-1-14(16(9-15)34-7-8-38-13-19(34,11-35)12-36)10-32-3-5-33(6-4-32)18(37)39-17(21(26,27)28)22(29,30)31/h1-2,9,11,17,36H,3-8,10,12-13H2 |
| InChIKey | SGZVFOJYBBTRDO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|