C19H20F9N3O4 — CID 134532368
(2R)-2-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)anilino]propanoic acid (PubChem CID 134532368) has the molecular formula C19H20F9N3O4 and a molecular weight of 525.37 g/mol. Its IUPAC name is (2R)-2-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)anilino]propanoic acid.
| Compound Name | (2R)-2-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 134532368 |
| Molecular Formula | C19H20F9N3O4 |
| Molecular Weight | 525.37 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | (2R)-2-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)anilino]propanoic acid |
| SMILES | C[C@@H](Nc1cc(C(F)(F)F)ccc1CN1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1)C(=O)O |
| InChI | InChI=1S/C19H20F9N3O4/c1-10(14(32)33)29-13-8-12(17(20,21)22)3-2-11(13)9-30-4-6-31(7-5-30)16(34)35-15(18(23,24)25)19(26,27)28/h2-3,8,10,15,29H,4-7,9H2,1H3,(H,32,33)/t10-/m1/s1 |
| InChIKey | JQFHJRWIUWRSPO-SNVBAGLBSA-N |
| XLogP | 4.34 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |