C27H36F9N3O2 — CID 145401365
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(azepan-1-yl)-4-(trifluoromethyl)phenyl]methyl-ethylamino]-4-ethylpiperidine-1-carboxylate (PubChem CID 145401365) has the molecular formula C27H36F9N3O2 and a molecular weight of 605.59 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(azepan-1-yl)-4-(trifluoromethyl)phenyl]methyl-ethylamino]-4-ethylpiperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(azepan-1-yl)-4-(trifluoromethyl)phenyl]methyl-ethylamino]-4-ethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 145401365 |
| Molecular Formula | C27H36F9N3O2 |
| Molecular Weight | 605.59 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-(azepan-1-yl)-4-(trifluoromethyl)phenyl]methyl-ethylamino]-4-ethylpiperidine-1-carboxylate |
| SMILES | CCN(Cc1ccc(C(F)(F)F)cc1N1CCCCCC1)C1(CC)CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C27H36F9N3O2/c1-3-24(11-15-38(16-12-24)23(40)41-22(26(31,32)33)27(34,35)36)39(4-2)18-19-9-10-20(25(28,29)30)17-21(19)37-13-7-5-6-8-14-37/h9-10,17,22H,3-8,11-16,18H2,1-2H3 |
| InChIKey | CULYNNVBTRYRDL-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.59 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |