C26H30F6N4O4 — CID 140887947
1-[3-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]-5-isocyanophenyl]piperidine-4-carboxylic acid (PubChem CID 140887947) has the molecular formula C26H30F6N4O4 and a molecular weight of 576.54 g/mol. Its IUPAC name is 1-[3-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]-5-isocyanophenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]-5-isocyanophenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 140887947 |
| Molecular Formula | C26H30F6N4O4 |
| Molecular Weight | 576.54 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | 1-[3-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]-5-isocyanophenyl]piperidine-4-carboxylic acid |
| SMILES | [C-]#[N+]c1cc(CN2CCCC23CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC3)cc(N2CCC(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C26H30F6N4O4/c1-33-19-13-17(14-20(15-19)34-9-3-18(4-10-34)21(37)38)16-36-8-2-5-24(36)6-11-35(12-7-24)23(39)40-22(25(27,28)29)26(30,31)32/h13-15,18,22H,2-12,16H2,(H,37,38) |
| InChIKey | RQTSVXUKYRBJII-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|