C24H27ClF6N2O5 — CID 134524425
1-[[5-chloro-2-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]phenoxy]methyl]cyclopropane-1-carboxylic acid (PubChem CID 134524425) has the molecular formula C24H27ClF6N2O5 and a molecular weight of 572.93 g/mol. Its IUPAC name is 1-[[5-chloro-2-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]phenoxy]methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[[5-chloro-2-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]phenoxy]methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 134524425 |
| Molecular Formula | C24H27ClF6N2O5 |
| Molecular Weight | 572.93 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | 1-[[5-chloro-2-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-1,8-diazaspiro[4.5]decan-1-yl]methyl]phenoxy]methyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC2(CCCN2Cc2ccc(Cl)cc2OCC2(C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C24H27ClF6N2O5/c25-16-3-2-15(17(12-16)37-14-21(5-6-21)19(34)35)13-33-9-1-4-22(33)7-10-32(11-8-22)20(36)38-18(23(26,27)28)24(29,30)31/h2-3,12,18H,1,4-11,13-14H2,(H,34,35) |
| InChIKey | WJDYHJPJTQJOOS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.93 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |