C25H30ClF6N3O3 — CID 155440976
1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-chloro-3-[(5S)-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 155440976) has the molecular formula C25H30ClF6N3O3 and a molecular weight of 569.97 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-chloro-3-[(5S)-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-chloro-3-[(5S)-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 155440976 |
| Molecular Formula | C25H30ClF6N3O3 |
| Molecular Weight | 569.97 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-chloro-3-[(5S)-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC2(CCCN2Cc2cccc(N3C4CC[C@H]3COC4)c2Cl)CC1 |
| InChI | InChI=1S/C25H30ClF6N3O3/c26-20-16(3-1-4-19(20)35-17-5-6-18(35)15-37-14-17)13-34-10-2-7-23(34)8-11-33(12-9-23)22(36)38-21(24(27,28)29)25(30,31)32/h1,3-4,17-18,21H,2,5-15H2/t17-,18?/m0/s1 |
| InChIKey | BLCOJQQWSPPTIE-ZENAZSQFSA-N |
| XLogP | 5.77 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.97 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |